About 4-(3-nitrophenyl)-3,4-dihydro-1H-benzo[h]quinolin-2-one
4-(3-nitrophenyl)-3,4-dihydro-1H-benzo[h]quinolin-2-one (PubChem CID 2854638) has the molecular formula C19H14N2O3
and a molecular weight of 318.33 g/mol. Its IUPAC name is 4-(3-nitrophenyl)-3,4-dihydro-1H-benzo[h]quinolin-2-one.
Molecular Properties
| Compound Name | 4-(3-nitrophenyl)-3,4-dihydro-1H-benzo[h]quinolin-2-one |
| PubChem CID | 2854638 |
| Molecular Formula | C19H14N2O3 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 4-(3-nitrophenyl)-3,4-dihydro-1H-benzo[h]quinolin-2-one |
| SMILES | O=C1CC(c2cccc([N+](=O)[O-])c2)c2ccc3ccccc3c2N1 |
| InChI | InChI=1S/C19H14N2O3/c22-18-11-17(13-5-3-6-14(10-13)21(23)24)16-9-8-12-4-1-2-7-15(12)19(16)20-18/h1-10,17H,11H2,(H,20,22) |
| InChIKey | PZEQKGJBRUUZSW-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-nitrophenyl)-3,4-dihydro-1H-benzo[h]quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-nitrophenyl)-3,4-dihydro-1H-benzo[h]quinolin-2-one?
The IUPAC name of 4-(3-nitrophenyl)-3,4-dihydro-1H-benzo[h]quinolin-2-one (CID 2854638) is 4-(3-nitrophenyl)-3,4-dihydro-1H-benzo[h]quinolin-2-one.
What is the SMILES notation for 4-(3-nitrophenyl)-3,4-dihydro-1H-benzo[h]quinolin-2-one?
The canonical SMILES for 4-(3-nitrophenyl)-3,4-dihydro-1H-benzo[h]quinolin-2-one is O=C1CC(c2cccc([N+](=O)[O-])c2)c2ccc3ccccc3c2N1.
What is the InChIKey of 4-(3-nitrophenyl)-3,4-dihydro-1H-benzo[h]quinolin-2-one?
The InChIKey is PZEQKGJBRUUZSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14N2O3/c22-18-11-17(13-5-3-6-14(10-13)21(23)24)16-9-8-12-4-1-2-7-15(12)19(16)20-18/h1-10,17H,11H2,(H,20,22).
What are the key properties of 4-(3-nitrophenyl)-3,4-dihydro-1H-benzo[h]quinolin-2-one?
4-(3-nitrophenyl)-3,4-dihydro-1H-benzo[h]quinolin-2-one has a molecular weight of 318.33 g/mol, XLogP of 4.22, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-nitrophenyl)-3,4-dihydro-1H-benzo[h]quinolin-2-one is sourced from PubChem (CID 2854638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).