About 3-chloro-N-[(3S)-1,1-dioxothiolan-3-yl]-5-(trifluoromethyl)pyridin-2-amine
3-chloro-N-[(3S)-1,1-dioxothiolan-3-yl]-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 28548311) has the molecular formula C10H10ClF3N2O2S
and a molecular weight of 314.72 g/mol. Its IUPAC name is 3-chloro-N-[(3S)-1,1-dioxothiolan-3-yl]-5-(trifluoromethyl)pyridin-2-amine.
Molecular Properties
| Compound Name | 3-chloro-N-[(3S)-1,1-dioxothiolan-3-yl]-5-(trifluoromethyl)pyridin-2-amine |
| PubChem CID | 28548311 |
| Molecular Formula | C10H10ClF3N2O2S |
| Molecular Weight | 314.72 g/mol |
| Exact Mass | 314.01 |
| IUPAC Name | 3-chloro-N-[(3S)-1,1-dioxothiolan-3-yl]-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | O=S1(=O)CC[C@H](Nc2ncc(C(F)(F)F)cc2Cl)C1 |
| InChI | InChI=1S/C10H10ClF3N2O2S/c11-8-3-6(10(12,13)14)4-15-9(8)16-7-1-2-19(17,18)5-7/h3-4,7H,1-2,5H2,(H,15,16)/t7-/m0/s1 |
| InChIKey | VNHSRACBMIAAMH-ZETCQYMHSA-N |
| XLogP | 2.35 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.72 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-chloro-N-[(3S)-1,1-dioxothiolan-3-yl]-5-(trifluoromethyl)pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N-[(3S)-1,1-dioxothiolan-3-yl]-5-(trifluoromethyl)pyridin-2-amine?
The IUPAC name of 3-chloro-N-[(3S)-1,1-dioxothiolan-3-yl]-5-(trifluoromethyl)pyridin-2-amine (CID 28548311) is 3-chloro-N-[(3S)-1,1-dioxothiolan-3-yl]-5-(trifluoromethyl)pyridin-2-amine.
What is the SMILES notation for 3-chloro-N-[(3S)-1,1-dioxothiolan-3-yl]-5-(trifluoromethyl)pyridin-2-amine?
The canonical SMILES for 3-chloro-N-[(3S)-1,1-dioxothiolan-3-yl]-5-(trifluoromethyl)pyridin-2-amine is O=S1(=O)CC[C@H](Nc2ncc(C(F)(F)F)cc2Cl)C1.
What is the InChIKey of 3-chloro-N-[(3S)-1,1-dioxothiolan-3-yl]-5-(trifluoromethyl)pyridin-2-amine?
The InChIKey is VNHSRACBMIAAMH-ZETCQYMHSA-N. The full InChI is InChI=1S/C10H10ClF3N2O2S/c11-8-3-6(10(12,13)14)4-15-9(8)16-7-1-2-19(17,18)5-7/h3-4,7H,1-2,5H2,(H,15,16)/t7-/m0/s1.
What are the key properties of 3-chloro-N-[(3S)-1,1-dioxothiolan-3-yl]-5-(trifluoromethyl)pyridin-2-amine?
3-chloro-N-[(3S)-1,1-dioxothiolan-3-yl]-5-(trifluoromethyl)pyridin-2-amine has a molecular weight of 314.72 g/mol, XLogP of 2.35, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N-[(3S)-1,1-dioxothiolan-3-yl]-5-(trifluoromethyl)pyridin-2-amine is sourced from PubChem (CID 28548311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).