C16H17Cl3N2O5 — CID 2854970
2,2,2-trichloroethyl 4-(2,5-dimethoxyphenyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 2854970) has the molecular formula C16H17Cl3N2O5 and a molecular weight of 423.68 g/mol. Its IUPAC name is 2,2,2-trichloroethyl 4-(2,5-dimethoxyphenyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | 2,2,2-trichloroethyl 4-(2,5-dimethoxyphenyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 2854970 |
| Molecular Formula | C16H17Cl3N2O5 |
| Molecular Weight | 423.68 g/mol |
| Exact Mass | 422.02 |
| IUPAC Name | 2,2,2-trichloroethyl 4-(2,5-dimethoxyphenyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | COc1ccc(OC)c(C2NC(=O)NC(C)=C2C(=O)OCC(Cl)(Cl)Cl)c1 |
| InChI | InChI=1S/C16H17Cl3N2O5/c1-8-12(14(22)26-7-16(17,18)19)13(21-15(23)20-8)10-6-9(24-2)4-5-11(10)25-3/h4-6,13H,7H2,1-3H3,(H2,20,21,23) |
| InChIKey | YHHIBQNYLHMTBV-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.68 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|