About N-(4-fluorophenyl)-N'-[(1-methylpiperidin-4-ylidene)amino]oxamide
N-(4-fluorophenyl)-N'-[(1-methylpiperidin-4-ylidene)amino]oxamide (PubChem CID 2855032) has the molecular formula C14H17FN4O2
and a molecular weight of 292.31 g/mol. Its IUPAC name is N-(4-fluorophenyl)-N'-[(1-methylpiperidin-4-ylidene)amino]oxamide.
Molecular Properties
| Compound Name | N-(4-fluorophenyl)-N'-[(1-methylpiperidin-4-ylidene)amino]oxamide |
| PubChem CID | 2855032 |
| Molecular Formula | C14H17FN4O2 |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | N-(4-fluorophenyl)-N'-[(1-methylpiperidin-4-ylidene)amino]oxamide |
| SMILES | CN1CCC(=NNC(=O)C(=O)Nc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C14H17FN4O2/c1-19-8-6-12(7-9-19)17-18-14(21)13(20)16-11-4-2-10(15)3-5-11/h2-5H,6-9H2,1H3,(H,16,20)(H,18,21) |
| InChIKey | HUSVODBQXJDLAB-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(4-fluorophenyl)-N'-[(1-methylpiperidin-4-ylidene)amino]oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-fluorophenyl)-N'-[(1-methylpiperidin-4-ylidene)amino]oxamide?
The IUPAC name of N-(4-fluorophenyl)-N'-[(1-methylpiperidin-4-ylidene)amino]oxamide (CID 2855032) is N-(4-fluorophenyl)-N'-[(1-methylpiperidin-4-ylidene)amino]oxamide.
What is the SMILES notation for N-(4-fluorophenyl)-N'-[(1-methylpiperidin-4-ylidene)amino]oxamide?
The canonical SMILES for N-(4-fluorophenyl)-N'-[(1-methylpiperidin-4-ylidene)amino]oxamide is CN1CCC(=NNC(=O)C(=O)Nc2ccc(F)cc2)CC1.
What is the InChIKey of N-(4-fluorophenyl)-N'-[(1-methylpiperidin-4-ylidene)amino]oxamide?
The InChIKey is HUSVODBQXJDLAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17FN4O2/c1-19-8-6-12(7-9-19)17-18-14(21)13(20)16-11-4-2-10(15)3-5-11/h2-5H,6-9H2,1H3,(H,16,20)(H,18,21).
What are the key properties of N-(4-fluorophenyl)-N'-[(1-methylpiperidin-4-ylidene)amino]oxamide?
N-(4-fluorophenyl)-N'-[(1-methylpiperidin-4-ylidene)amino]oxamide has a molecular weight of 292.31 g/mol, XLogP of 0.96, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-fluorophenyl)-N'-[(1-methylpiperidin-4-ylidene)amino]oxamide is sourced from PubChem (CID 2855032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).