C20H20ClF3N2O4S — CID 28550625
(3S)-1-(3-chloro-4-ethoxyphenyl)sulfonyl-N-(2,3,4-trifluorophenyl)piperidine-3-carboxamide (PubChem CID 28550625) has the molecular formula C20H20ClF3N2O4S and a molecular weight of 476.90 g/mol. Its IUPAC name is (3S)-1-(3-chloro-4-ethoxyphenyl)sulfonyl-N-(2,3,4-trifluorophenyl)piperidine-3-carboxamide.
| Compound Name | (3S)-1-(3-chloro-4-ethoxyphenyl)sulfonyl-N-(2,3,4-trifluorophenyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 28550625 |
| Molecular Formula | C20H20ClF3N2O4S |
| Molecular Weight | 476.90 g/mol |
| Exact Mass | 476.08 |
| IUPAC Name | (3S)-1-(3-chloro-4-ethoxyphenyl)sulfonyl-N-(2,3,4-trifluorophenyl)piperidine-3-carboxamide |
| SMILES | CCOc1ccc(S(=O)(=O)N2CCC[C@H](C(=O)Nc3ccc(F)c(F)c3F)C2)cc1Cl |
| InChI | InChI=1S/C20H20ClF3N2O4S/c1-2-30-17-8-5-13(10-14(17)21)31(28,29)26-9-3-4-12(11-26)20(27)25-16-7-6-15(22)18(23)19(16)24/h5-8,10,12H,2-4,9,11H2,1H3,(H,25,27)/t12-/m0/s1 |
| InChIKey | IEQHAYHDWHVQGA-LBPRGKRZSA-N |
| XLogP | 4.20 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.90 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|