About 4-hydroxyoct-2-enal
4-hydroxyoct-2-enal (PubChem CID 28551) has the molecular formula C8H14O2
and a molecular weight of 142.20 g/mol. Its IUPAC name is 4-hydroxyoct-2-enal.
Molecular Properties
| Compound Name | 4-hydroxyoct-2-enal |
| PubChem CID | 28551 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | 4-hydroxyoct-2-enal |
| SMILES | CCCCC(O)C=CC=O |
| InChI | InChI=1S/C8H14O2/c1-2-3-5-8(10)6-4-7-9/h4,6-8,10H,2-3,5H2,1H3 |
| InChIKey | PYWFGGNTBVBZAT-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxyoct-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxyoct-2-enal?
The IUPAC name of 4-hydroxyoct-2-enal (CID 28551) is 4-hydroxyoct-2-enal.
What is the SMILES notation for 4-hydroxyoct-2-enal?
The canonical SMILES for 4-hydroxyoct-2-enal is CCCCC(O)C=CC=O.
What is the InChIKey of 4-hydroxyoct-2-enal?
The InChIKey is PYWFGGNTBVBZAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O2/c1-2-3-5-8(10)6-4-7-9/h4,6-8,10H,2-3,5H2,1H3.
What are the key properties of 4-hydroxyoct-2-enal?
4-hydroxyoct-2-enal has a molecular weight of 142.20 g/mol, XLogP of 1.29, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxyoct-2-enal is sourced from PubChem (CID 28551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).