C22H27BrN2O4S — CID 28551898
N-[(1R)-1-(3-bromophenyl)ethyl]-2-[4-(cyclohexylsulfamoyl)phenoxy]acetamide (PubChem CID 28551898) has the molecular formula C22H27BrN2O4S and a molecular weight of 495.44 g/mol. Its IUPAC name is N-[(1R)-1-(3-bromophenyl)ethyl]-2-[4-(cyclohexylsulfamoyl)phenoxy]acetamide.
| Compound Name | N-[(1R)-1-(3-bromophenyl)ethyl]-2-[4-(cyclohexylsulfamoyl)phenoxy]acetamide |
|---|---|
| PubChem CID | 28551898 |
| Molecular Formula | C22H27BrN2O4S |
| Molecular Weight | 495.44 g/mol |
| Exact Mass | 494.09 |
| IUPAC Name | N-[(1R)-1-(3-bromophenyl)ethyl]-2-[4-(cyclohexylsulfamoyl)phenoxy]acetamide |
| SMILES | C[C@@H](NC(=O)COc1ccc(S(=O)(=O)NC2CCCCC2)cc1)c1cccc(Br)c1 |
| InChI | InChI=1S/C22H27BrN2O4S/c1-16(17-6-5-7-18(23)14-17)24-22(26)15-29-20-10-12-21(13-11-20)30(27,28)25-19-8-3-2-4-9-19/h5-7,10-14,16,19,25H,2-4,8-9,15H2,1H3,(H,24,26)/t16-/m1/s1 |
| InChIKey | BMGRRAKYDOLSAB-MRXNPFEDSA-N |
| XLogP | 4.32 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.44 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |