C23H37ClN4O4 — CID 28552
4-butyl-1,2-dimethylpyrazolidine-3,5-dione;2-(4-chlorophenoxy)-N-[2-(diethylamino)ethyl]acetamide (PubChem CID 28552) has the molecular formula C23H37ClN4O4 and a molecular weight of 469.03 g/mol. Its IUPAC name is 4-butyl-1,2-dimethylpyrazolidine-3,5-dione;2-(4-chlorophenoxy)-N-[2-(diethylamino)ethyl]acetamide.
| Compound Name | 4-butyl-1,2-dimethylpyrazolidine-3,5-dione;2-(4-chlorophenoxy)-N-[2-(diethylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 28552 |
| Molecular Formula | C23H37ClN4O4 |
| Molecular Weight | 469.03 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | 4-butyl-1,2-dimethylpyrazolidine-3,5-dione;2-(4-chlorophenoxy)-N-[2-(diethylamino)ethyl]acetamide |
| SMILES | CCCCC1C(=O)N(C)N(C)C1=O.CCN(CC)CCNC(=O)COc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H21ClN2O2.C9H16N2O2/c1-3-17(4-2)10-9-16-14(18)11-19-13-7-5-12(15)6-8-13;1-4-5-6-7-8(12)10(2)11(3)9(7)13/h5-8H,3-4,9-11H2,1-2H3,(H,16,18);7H,4-6H2,1-3H3 |
| InChIKey | ZMNFDNGOKBWIAO-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.03 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|