C25H28N2O5S — CID 28552297
N-[(1S)-1-(4-methoxyphenyl)ethyl]-2-[4-[[(1R)-1-phenylethyl]sulfamoyl]phenoxy]acetamide (PubChem CID 28552297) has the molecular formula C25H28N2O5S and a molecular weight of 468.58 g/mol. Its IUPAC name is N-[(1S)-1-(4-methoxyphenyl)ethyl]-2-[4-[[(1R)-1-phenylethyl]sulfamoyl]phenoxy]acetamide.
| Compound Name | N-[(1S)-1-(4-methoxyphenyl)ethyl]-2-[4-[[(1R)-1-phenylethyl]sulfamoyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 28552297 |
| Molecular Formula | C25H28N2O5S |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | N-[(1S)-1-(4-methoxyphenyl)ethyl]-2-[4-[[(1R)-1-phenylethyl]sulfamoyl]phenoxy]acetamide |
| SMILES | COc1ccc([C@H](C)NC(=O)COc2ccc(S(=O)(=O)N[C@H](C)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C25H28N2O5S/c1-18(21-9-11-22(31-3)12-10-21)26-25(28)17-32-23-13-15-24(16-14-23)33(29,30)27-19(2)20-7-5-4-6-8-20/h4-16,18-19,27H,17H2,1-3H3,(H,26,28)/t18-,19+/m0/s1 |
| InChIKey | IQRNVZHVIQPHNF-RBUKOAKNSA-N |
| XLogP | 3.99 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |