C22H20F2N2O4S — CID 28553221
N-(3,4-difluorophenyl)-2-[4-[(3,4-dimethylphenyl)sulfamoyl]phenoxy]acetamide (PubChem CID 28553221) has the molecular formula C22H20F2N2O4S and a molecular weight of 446.48 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-2-[4-[(3,4-dimethylphenyl)sulfamoyl]phenoxy]acetamide.
| Compound Name | N-(3,4-difluorophenyl)-2-[4-[(3,4-dimethylphenyl)sulfamoyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 28553221 |
| Molecular Formula | C22H20F2N2O4S |
| Molecular Weight | 446.48 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | N-(3,4-difluorophenyl)-2-[4-[(3,4-dimethylphenyl)sulfamoyl]phenoxy]acetamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(OCC(=O)Nc3ccc(F)c(F)c3)cc2)cc1C |
| InChI | InChI=1S/C22H20F2N2O4S/c1-14-3-4-17(11-15(14)2)26-31(28,29)19-8-6-18(7-9-19)30-13-22(27)25-16-5-10-20(23)21(24)12-16/h3-12,26H,13H2,1-2H3,(H,25,27) |
| InChIKey | MGIDYALFZSRBIF-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.48 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |