About N-methyl-1-(2,4,6-trimethylcyclohex-3-en-1-yl)methanamine
N-methyl-1-(2,4,6-trimethylcyclohex-3-en-1-yl)methanamine (PubChem CID 2855350) has the molecular formula C11H21N
and a molecular weight of 167.30 g/mol. Its IUPAC name is N-methyl-1-(2,4,6-trimethylcyclohex-3-en-1-yl)methanamine.
Molecular Properties
| Compound Name | N-methyl-1-(2,4,6-trimethylcyclohex-3-en-1-yl)methanamine |
| PubChem CID | 2855350 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | N-methyl-1-(2,4,6-trimethylcyclohex-3-en-1-yl)methanamine |
| SMILES | CNCC1C(C)C=C(C)CC1C |
| InChI | InChI=1S/C11H21N/c1-8-5-9(2)11(7-12-4)10(3)6-8/h5,9-12H,6-7H2,1-4H3 |
| InChIKey | PWAQHLVFMIZZFN-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-1-(2,4,6-trimethylcyclohex-3-en-1-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1-(2,4,6-trimethylcyclohex-3-en-1-yl)methanamine?
The IUPAC name of N-methyl-1-(2,4,6-trimethylcyclohex-3-en-1-yl)methanamine (CID 2855350) is N-methyl-1-(2,4,6-trimethylcyclohex-3-en-1-yl)methanamine.
What is the SMILES notation for N-methyl-1-(2,4,6-trimethylcyclohex-3-en-1-yl)methanamine?
The canonical SMILES for N-methyl-1-(2,4,6-trimethylcyclohex-3-en-1-yl)methanamine is CNCC1C(C)C=C(C)CC1C.
What is the InChIKey of N-methyl-1-(2,4,6-trimethylcyclohex-3-en-1-yl)methanamine?
The InChIKey is PWAQHLVFMIZZFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N/c1-8-5-9(2)11(7-12-4)10(3)6-8/h5,9-12H,6-7H2,1-4H3.
What are the key properties of N-methyl-1-(2,4,6-trimethylcyclohex-3-en-1-yl)methanamine?
N-methyl-1-(2,4,6-trimethylcyclohex-3-en-1-yl)methanamine has a molecular weight of 167.30 g/mol, XLogP of 2.44, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1-(2,4,6-trimethylcyclohex-3-en-1-yl)methanamine is sourced from PubChem (CID 2855350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).