About 2,3-dichloro-N-[(3,4-difluorophenyl)methyl]aniline
2,3-dichloro-N-[(3,4-difluorophenyl)methyl]aniline (PubChem CID 28555566) has the molecular formula C13H9Cl2F2N
and a molecular weight of 288.12 g/mol. Its IUPAC name is 2,3-dichloro-N-[(3,4-difluorophenyl)methyl]aniline.
Molecular Properties
| Compound Name | 2,3-dichloro-N-[(3,4-difluorophenyl)methyl]aniline |
| PubChem CID | 28555566 |
| Molecular Formula | C13H9Cl2F2N |
| Molecular Weight | 288.12 g/mol |
| Exact Mass | 287.01 |
| IUPAC Name | 2,3-dichloro-N-[(3,4-difluorophenyl)methyl]aniline |
| SMILES | Fc1ccc(CNc2cccc(Cl)c2Cl)cc1F |
| InChI | InChI=1S/C13H9Cl2F2N/c14-9-2-1-3-12(13(9)15)18-7-8-4-5-10(16)11(17)6-8/h1-6,18H,7H2 |
| InChIKey | QRFCZGNMJLXHIN-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.12 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,3-dichloro-N-[(3,4-difluorophenyl)methyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dichloro-N-[(3,4-difluorophenyl)methyl]aniline?
The IUPAC name of 2,3-dichloro-N-[(3,4-difluorophenyl)methyl]aniline (CID 28555566) is 2,3-dichloro-N-[(3,4-difluorophenyl)methyl]aniline.
What is the SMILES notation for 2,3-dichloro-N-[(3,4-difluorophenyl)methyl]aniline?
The canonical SMILES for 2,3-dichloro-N-[(3,4-difluorophenyl)methyl]aniline is Fc1ccc(CNc2cccc(Cl)c2Cl)cc1F.
What is the InChIKey of 2,3-dichloro-N-[(3,4-difluorophenyl)methyl]aniline?
The InChIKey is QRFCZGNMJLXHIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9Cl2F2N/c14-9-2-1-3-12(13(9)15)18-7-8-4-5-10(16)11(17)6-8/h1-6,18H,7H2.
What are the key properties of 2,3-dichloro-N-[(3,4-difluorophenyl)methyl]aniline?
2,3-dichloro-N-[(3,4-difluorophenyl)methyl]aniline has a molecular weight of 288.12 g/mol, XLogP of 4.88, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dichloro-N-[(3,4-difluorophenyl)methyl]aniline is sourced from PubChem (CID 28555566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).