C20H20ClN5O4 — CID 2855584
3-[2-[4-(2-chloro-4-nitrophenyl)piperazin-1-yl]ethoxy]-4-phenyl-1,2,5-oxadiazole (PubChem CID 2855584) has the molecular formula C20H20ClN5O4 and a molecular weight of 429.86 g/mol. Its IUPAC name is 3-[2-[4-(2-chloro-4-nitrophenyl)piperazin-1-yl]ethoxy]-4-phenyl-1,2,5-oxadiazole.
| Compound Name | 3-[2-[4-(2-chloro-4-nitrophenyl)piperazin-1-yl]ethoxy]-4-phenyl-1,2,5-oxadiazole |
|---|---|
| PubChem CID | 2855584 |
| Molecular Formula | C20H20ClN5O4 |
| Molecular Weight | 429.86 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | 3-[2-[4-(2-chloro-4-nitrophenyl)piperazin-1-yl]ethoxy]-4-phenyl-1,2,5-oxadiazole |
| SMILES | O=[N+]([O-])c1ccc(N2CCN(CCOc3nonc3-c3ccccc3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C20H20ClN5O4/c21-17-14-16(26(27)28)6-7-18(17)25-10-8-24(9-11-25)12-13-29-20-19(22-30-23-20)15-4-2-1-3-5-15/h1-7,14H,8-13H2 |
| InChIKey | DXQOIUIKKLEKLP-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 97.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.86 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|