C19H36N2 — CID 2855628
N',N'-dimethyl-N-[[6-methyl-4-(4-methylpent-3-enyl)cyclohex-3-en-1-yl]methyl]propane-1,3-diamine (PubChem CID 2855628) has the molecular formula C19H36N2 and a molecular weight of 292.51 g/mol. Its IUPAC name is N',N'-dimethyl-N-[[6-methyl-4-(4-methylpent-3-enyl)cyclohex-3-en-1-yl]methyl]propane-1,3-diamine.
| Compound Name | N',N'-dimethyl-N-[[6-methyl-4-(4-methylpent-3-enyl)cyclohex-3-en-1-yl]methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 2855628 |
| Molecular Formula | C19H36N2 |
| Molecular Weight | 292.51 g/mol |
| Exact Mass | 292.29 |
| IUPAC Name | N',N'-dimethyl-N-[[6-methyl-4-(4-methylpent-3-enyl)cyclohex-3-en-1-yl]methyl]propane-1,3-diamine |
| SMILES | CC(C)=CCCC1=CCC(CNCCCN(C)C)C(C)C1 |
| InChI | InChI=1S/C19H36N2/c1-16(2)8-6-9-18-10-11-19(17(3)14-18)15-20-12-7-13-21(4)5/h8,10,17,19-20H,6-7,9,11-15H2,1-5H3 |
| InChIKey | RFROODWOQYPGPX-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.51 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|