C22H27ClN2O4S — CID 28556462
2-[4-(butylsulfamoyl)-2-chlorophenoxy]-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide (PubChem CID 28556462) has the molecular formula C22H27ClN2O4S and a molecular weight of 450.99 g/mol. Its IUPAC name is 2-[4-(butylsulfamoyl)-2-chlorophenoxy]-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide.
| Compound Name | 2-[4-(butylsulfamoyl)-2-chlorophenoxy]-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide |
|---|---|
| PubChem CID | 28556462 |
| Molecular Formula | C22H27ClN2O4S |
| Molecular Weight | 450.99 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | 2-[4-(butylsulfamoyl)-2-chlorophenoxy]-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide |
| SMILES | CCCCNS(=O)(=O)c1ccc(OCC(=O)N[C@@H]2CCCc3ccccc32)c(Cl)c1 |
| InChI | InChI=1S/C22H27ClN2O4S/c1-2-3-13-24-30(27,28)17-11-12-21(19(23)14-17)29-15-22(26)25-20-10-6-8-16-7-4-5-9-18(16)20/h4-5,7,9,11-12,14,20,24H,2-3,6,8,10,13,15H2,1H3,(H,25,26)/t20-/m1/s1 |
| InChIKey | SDILCRLBBWVKAV-HXUWFJFHSA-N |
| XLogP | 3.99 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.99 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|