C16H16Cl2N2O3 — CID 2855705
but-2-enyl 4-(2,4-dichlorophenyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 2855705) has the molecular formula C16H16Cl2N2O3 and a molecular weight of 355.22 g/mol. Its IUPAC name is but-2-enyl 4-(2,4-dichlorophenyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | but-2-enyl 4-(2,4-dichlorophenyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 2855705 |
| Molecular Formula | C16H16Cl2N2O3 |
| Molecular Weight | 355.22 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | but-2-enyl 4-(2,4-dichlorophenyl)-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CC=CCOC(=O)C1=C(C)NC(=O)NC1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H16Cl2N2O3/c1-3-4-7-23-15(21)13-9(2)19-16(22)20-14(13)11-6-5-10(17)8-12(11)18/h3-6,8,14H,7H2,1-2H3,(H2,19,20,22) |
| InChIKey | ZFYYISFNPWTRFI-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.22 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|