C17H20BrNO2S — CID 28560356
N-[(1R)-1-(3-bromophenyl)ethyl]-2,4,6-trimethylbenzenesulfonamide (PubChem CID 28560356) has the molecular formula C17H20BrNO2S and a molecular weight of 382.32 g/mol. Its IUPAC name is N-[(1R)-1-(3-bromophenyl)ethyl]-2,4,6-trimethylbenzenesulfonamide.
| Compound Name | N-[(1R)-1-(3-bromophenyl)ethyl]-2,4,6-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 28560356 |
| Molecular Formula | C17H20BrNO2S |
| Molecular Weight | 382.32 g/mol |
| Exact Mass | 381.04 |
| IUPAC Name | N-[(1R)-1-(3-bromophenyl)ethyl]-2,4,6-trimethylbenzenesulfonamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)N[C@H](C)c2cccc(Br)c2)c(C)c1 |
| InChI | InChI=1S/C17H20BrNO2S/c1-11-8-12(2)17(13(3)9-11)22(20,21)19-14(4)15-6-5-7-16(18)10-15/h5-10,14,19H,1-4H3/t14-/m1/s1 |
| InChIKey | MTVCKOOBZULKSM-CQSZACIVSA-N |
| XLogP | 4.41 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.32 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |