C11H13ClN2O — CID 28563439
N-(2-chlorophenyl)-2-(prop-2-enylamino)acetamide (PubChem CID 28563439) has the molecular formula C11H13ClN2O and a molecular weight of 224.69 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-(prop-2-enylamino)acetamide.
| Compound Name | N-(2-chlorophenyl)-2-(prop-2-enylamino)acetamide |
|---|---|
| PubChem CID | 28563439 |
| Molecular Formula | C11H13ClN2O |
| Molecular Weight | 224.69 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | N-(2-chlorophenyl)-2-(prop-2-enylamino)acetamide |
| SMILES | C=CCNCC(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C11H13ClN2O/c1-2-7-13-8-11(15)14-10-6-4-3-5-9(10)12/h2-6,13H,1,7-8H2,(H,14,15) |
| InChIKey | NEFBKKHQAASOOZ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.69 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|