C14H18N2O — CID 28564060
N,N-diethyl-2-(3-ethynylanilino)acetamide (PubChem CID 28564060) has the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. Its IUPAC name is N,N-diethyl-2-(3-ethynylanilino)acetamide.
| Compound Name | N,N-diethyl-2-(3-ethynylanilino)acetamide |
|---|---|
| PubChem CID | 28564060 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | N,N-diethyl-2-(3-ethynylanilino)acetamide |
| SMILES | C#Cc1cccc(NCC(=O)N(CC)CC)c1 |
| InChI | InChI=1S/C14H18N2O/c1-4-12-8-7-9-13(10-12)15-11-14(17)16(5-2)6-3/h1,7-10,15H,5-6,11H2,2-3H3 |
| InChIKey | UIBZDYRDOGFYTQ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|