C12H5F7N2S — CID 2856530
2,3,5,6-tetrafluoro-N-(thiophen-2-ylmethylideneamino)-4-(trifluoromethyl)aniline (PubChem CID 2856530) has the molecular formula C12H5F7N2S and a molecular weight of 342.24 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-N-(thiophen-2-ylmethylideneamino)-4-(trifluoromethyl)aniline.
| Compound Name | 2,3,5,6-tetrafluoro-N-(thiophen-2-ylmethylideneamino)-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 2856530 |
| Molecular Formula | C12H5F7N2S |
| Molecular Weight | 342.24 g/mol |
| Exact Mass | 342.01 |
| IUPAC Name | 2,3,5,6-tetrafluoro-N-(thiophen-2-ylmethylideneamino)-4-(trifluoromethyl)aniline |
| SMILES | Fc1c(F)c(C(F)(F)F)c(F)c(F)c1NN=Cc1cccs1 |
| InChI | InChI=1S/C12H5F7N2S/c13-7-6(12(17,18)19)8(14)10(16)11(9(7)15)21-20-4-5-2-1-3-22-5/h1-4,21H |
| InChIKey | PUWBYRYCTCLZNB-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.24 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_thiophene_B(4)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|