C17H26N2O3S2 — CID 28566256
N-(2-tert-butylsulfanylethyl)-3-methyl-4-(2-oxopyrrolidin-1-yl)benzenesulfonamide (PubChem CID 28566256) has the molecular formula C17H26N2O3S2 and a molecular weight of 370.54 g/mol. Its IUPAC name is N-(2-tert-butylsulfanylethyl)-3-methyl-4-(2-oxopyrrolidin-1-yl)benzenesulfonamide.
| Compound Name | N-(2-tert-butylsulfanylethyl)-3-methyl-4-(2-oxopyrrolidin-1-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 28566256 |
| Molecular Formula | C17H26N2O3S2 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | N-(2-tert-butylsulfanylethyl)-3-methyl-4-(2-oxopyrrolidin-1-yl)benzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NCCSC(C)(C)C)ccc1N1CCCC1=O |
| InChI | InChI=1S/C17H26N2O3S2/c1-13-12-14(7-8-15(13)19-10-5-6-16(19)20)24(21,22)18-9-11-23-17(2,3)4/h7-8,12,18H,5-6,9-11H2,1-4H3 |
| InChIKey | NURQSXZFXYUBBP-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|