C23H39N3O3 — CID 2856681
6-hydroxy-5-(octadec-9-enyliminomethyl)-1H-pyrimidine-2,4-dione (PubChem CID 2856681) has the molecular formula C23H39N3O3 and a molecular weight of 405.58 g/mol. Its IUPAC name is 6-hydroxy-5-(octadec-9-enyliminomethyl)-1H-pyrimidine-2,4-dione.
| Compound Name | 6-hydroxy-5-(octadec-9-enyliminomethyl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 2856681 |
| Molecular Formula | C23H39N3O3 |
| Molecular Weight | 405.58 g/mol |
| Exact Mass | 405.30 |
| IUPAC Name | 6-hydroxy-5-(octadec-9-enyliminomethyl)-1H-pyrimidine-2,4-dione |
| SMILES | CCCCCCCCC=CCCCCCCCC/N=C/c1c(O)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C23H39N3O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-24-19-20-21(27)25-23(29)26-22(20)28/h9-10,19H,2-8,11-18H2,1H3,(H3,25,26,27,28,29)/b10-9?,24-19+ |
| InChIKey | QAYGETDLMPWKHT-FESDKPIHSA-N |
| XLogP | 5.23 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.58 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|