C23H20ClNO3S — CID 28566816
ethyl 4-[(2-benzylsulfanylbenzoyl)amino]-2-chlorobenzoate (PubChem CID 28566816) has the molecular formula C23H20ClNO3S and a molecular weight of 425.94 g/mol. Its IUPAC name is ethyl 4-[(2-benzylsulfanylbenzoyl)amino]-2-chlorobenzoate.
| Compound Name | ethyl 4-[(2-benzylsulfanylbenzoyl)amino]-2-chlorobenzoate |
|---|---|
| PubChem CID | 28566816 |
| Molecular Formula | C23H20ClNO3S |
| Molecular Weight | 425.94 g/mol |
| Exact Mass | 425.09 |
| IUPAC Name | ethyl 4-[(2-benzylsulfanylbenzoyl)amino]-2-chlorobenzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)c2ccccc2SCc2ccccc2)cc1Cl |
| InChI | InChI=1S/C23H20ClNO3S/c1-2-28-23(27)18-13-12-17(14-20(18)24)25-22(26)19-10-6-7-11-21(19)29-15-16-8-4-3-5-9-16/h3-14H,2,15H2,1H3,(H,25,26) |
| InChIKey | BPDZXUWWCANVQW-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.94 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |