About N-(4-methoxyphenyl)-1,1-dioxothiolan-3-amine
N-(4-methoxyphenyl)-1,1-dioxothiolan-3-amine (PubChem CID 2856684) has the molecular formula C11H15NO3S
and a molecular weight of 241.31 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-1,1-dioxothiolan-3-amine.
Molecular Properties
| Compound Name | N-(4-methoxyphenyl)-1,1-dioxothiolan-3-amine |
| PubChem CID | 2856684 |
| Molecular Formula | C11H15NO3S |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.08 |
| IUPAC Name | N-(4-methoxyphenyl)-1,1-dioxothiolan-3-amine |
| SMILES | COc1ccc(NC2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C11H15NO3S/c1-15-11-4-2-9(3-5-11)12-10-6-7-16(13,14)8-10/h2-5,10,12H,6-8H2,1H3 |
| InChIKey | JWARIOINZRSQPD-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze N-(4-methoxyphenyl)-1,1-dioxothiolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-methoxyphenyl)-1,1-dioxothiolan-3-amine?
The IUPAC name of N-(4-methoxyphenyl)-1,1-dioxothiolan-3-amine (CID 2856684) is N-(4-methoxyphenyl)-1,1-dioxothiolan-3-amine.
What is the SMILES notation for N-(4-methoxyphenyl)-1,1-dioxothiolan-3-amine?
The canonical SMILES for N-(4-methoxyphenyl)-1,1-dioxothiolan-3-amine is COc1ccc(NC2CCS(=O)(=O)C2)cc1.
What is the InChIKey of N-(4-methoxyphenyl)-1,1-dioxothiolan-3-amine?
The InChIKey is JWARIOINZRSQPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO3S/c1-15-11-4-2-9(3-5-11)12-10-6-7-16(13,14)8-10/h2-5,10,12H,6-8H2,1H3.
What are the key properties of N-(4-methoxyphenyl)-1,1-dioxothiolan-3-amine?
N-(4-methoxyphenyl)-1,1-dioxothiolan-3-amine has a molecular weight of 241.31 g/mol, XLogP of 1.29, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-methoxyphenyl)-1,1-dioxothiolan-3-amine is sourced from PubChem (CID 2856684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).