C25H27ClN2O4S — CID 28569053
2-(N-(4-chlorophenyl)sulfonyl-2-methylanilino)-N-[(1S)-1-(4-ethoxyphenyl)ethyl]acetamide (PubChem CID 28569053) has the molecular formula C25H27ClN2O4S and a molecular weight of 487.02 g/mol. Its IUPAC name is 2-(N-(4-chlorophenyl)sulfonyl-2-methylanilino)-N-[(1S)-1-(4-ethoxyphenyl)ethyl]acetamide.
| Compound Name | 2-(N-(4-chlorophenyl)sulfonyl-2-methylanilino)-N-[(1S)-1-(4-ethoxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 28569053 |
| Molecular Formula | C25H27ClN2O4S |
| Molecular Weight | 487.02 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | 2-(N-(4-chlorophenyl)sulfonyl-2-methylanilino)-N-[(1S)-1-(4-ethoxyphenyl)ethyl]acetamide |
| SMILES | CCOc1ccc([C@H](C)NC(=O)CN(c2ccccc2C)S(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C25H27ClN2O4S/c1-4-32-22-13-9-20(10-14-22)19(3)27-25(29)17-28(24-8-6-5-7-18(24)2)33(30,31)23-15-11-21(26)12-16-23/h5-16,19H,4,17H2,1-3H3,(H,27,29)/t19-/m0/s1 |
| InChIKey | DTXWDMBFXMRWEB-IBGZPJMESA-N |
| XLogP | 5.12 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.02 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |