C22H17NO2 — CID 2856914
10-phenyl-7,8,10,10a-tetrahydro-6H-indeno[1,2-b]quinoline-9,11-dione (PubChem CID 2856914) has the molecular formula C22H17NO2 and a molecular weight of 327.38 g/mol. Its IUPAC name is 10-phenyl-7,8,10,10a-tetrahydro-6H-indeno[1,2-b]quinoline-9,11-dione.
| Compound Name | 10-phenyl-7,8,10,10a-tetrahydro-6H-indeno[1,2-b]quinoline-9,11-dione |
|---|---|
| PubChem CID | 2856914 |
| Molecular Formula | C22H17NO2 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 10-phenyl-7,8,10,10a-tetrahydro-6H-indeno[1,2-b]quinoline-9,11-dione |
| SMILES | O=C1CCCC2=C1C(c1ccccc1)C1C(=O)c3ccccc3C1=N2 |
| InChI | InChI=1S/C22H17NO2/c24-17-12-6-11-16-19(17)18(13-7-2-1-3-8-13)20-21(23-16)14-9-4-5-10-15(14)22(20)25/h1-5,7-10,18,20H,6,11-12H2 |
| InChIKey | CJFWICNRVVUMQB-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_phenone_B(1)', 'substructure': 'N/A'} |
|---|