About (3-methoxyphenyl)-(2,2,4-trimethyl-4-phenyl-3H-quinolin-1-yl)methanone
(3-methoxyphenyl)-(2,2,4-trimethyl-4-phenyl-3H-quinolin-1-yl)methanone (PubChem CID 2857192) has the molecular formula C26H27NO2
and a molecular weight of 385.51 g/mol. Its IUPAC name is (3-methoxyphenyl)-(2,2,4-trimethyl-4-phenyl-3H-quinolin-1-yl)methanone.
Molecular Properties
| Compound Name | (3-methoxyphenyl)-(2,2,4-trimethyl-4-phenyl-3H-quinolin-1-yl)methanone |
| PubChem CID | 2857192 |
| Molecular Formula | C26H27NO2 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | (3-methoxyphenyl)-(2,2,4-trimethyl-4-phenyl-3H-quinolin-1-yl)methanone |
| SMILES | COc1cccc(C(=O)N2c3ccccc3C(C)(c3ccccc3)CC2(C)C)c1 |
| InChI | InChI=1S/C26H27NO2/c1-25(2)18-26(3,20-12-6-5-7-13-20)22-15-8-9-16-23(22)27(25)24(28)19-11-10-14-21(17-19)29-4/h5-17H,18H2,1-4H3 |
| InChIKey | NHBLVYMMZNXZDJ-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3-methoxyphenyl)-(2,2,4-trimethyl-4-phenyl-3H-quinolin-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methoxyphenyl)-(2,2,4-trimethyl-4-phenyl-3H-quinolin-1-yl)methanone?
The IUPAC name of (3-methoxyphenyl)-(2,2,4-trimethyl-4-phenyl-3H-quinolin-1-yl)methanone (CID 2857192) is (3-methoxyphenyl)-(2,2,4-trimethyl-4-phenyl-3H-quinolin-1-yl)methanone.
What is the SMILES notation for (3-methoxyphenyl)-(2,2,4-trimethyl-4-phenyl-3H-quinolin-1-yl)methanone?
The canonical SMILES for (3-methoxyphenyl)-(2,2,4-trimethyl-4-phenyl-3H-quinolin-1-yl)methanone is COc1cccc(C(=O)N2c3ccccc3C(C)(c3ccccc3)CC2(C)C)c1.
What is the InChIKey of (3-methoxyphenyl)-(2,2,4-trimethyl-4-phenyl-3H-quinolin-1-yl)methanone?
The InChIKey is NHBLVYMMZNXZDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H27NO2/c1-25(2)18-26(3,20-12-6-5-7-13-20)22-15-8-9-16-23(22)27(25)24(28)19-11-10-14-21(17-19)29-4/h5-17H,18H2,1-4H3.
What are the key properties of (3-methoxyphenyl)-(2,2,4-trimethyl-4-phenyl-3H-quinolin-1-yl)methanone?
(3-methoxyphenyl)-(2,2,4-trimethyl-4-phenyl-3H-quinolin-1-yl)methanone has a molecular weight of 385.51 g/mol, XLogP of 5.83, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methoxyphenyl)-(2,2,4-trimethyl-4-phenyl-3H-quinolin-1-yl)methanone is sourced from PubChem (CID 2857192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).