C29H27NO4 — CID 2857263
1-(dimethoxymethyl)-17-(2-phenylethyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione (PubChem CID 2857263) has the molecular formula C29H27NO4 and a molecular weight of 453.54 g/mol. Its IUPAC name is 1-(dimethoxymethyl)-17-(2-phenylethyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione.
| Compound Name | 1-(dimethoxymethyl)-17-(2-phenylethyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
|---|---|
| PubChem CID | 2857263 |
| Molecular Formula | C29H27NO4 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | 1-(dimethoxymethyl)-17-(2-phenylethyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
| SMILES | COC(OC)C12c3ccccc3C(c3ccccc31)C1C(=O)N(CCc3ccccc3)C(=O)C12 |
| InChI | InChI=1S/C29H27NO4/c1-33-28(34-2)29-21-14-8-6-12-19(21)23(20-13-7-9-15-22(20)29)24-25(29)27(32)30(26(24)31)17-16-18-10-4-3-5-11-18/h3-15,23-25,28H,16-17H2,1-2H3 |
| InChIKey | HWNAFGOHPZGKRI-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|