C26H20BrNO2 — CID 2857289
2-(3-bromophenyl)-4,7-diphenyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 2857289) has the molecular formula C26H20BrNO2 and a molecular weight of 458.36 g/mol. Its IUPAC name is 2-(3-bromophenyl)-4,7-diphenyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | 2-(3-bromophenyl)-4,7-diphenyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 2857289 |
| Molecular Formula | C26H20BrNO2 |
| Molecular Weight | 458.36 g/mol |
| Exact Mass | 457.07 |
| IUPAC Name | 2-(3-bromophenyl)-4,7-diphenyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | O=C1C2C(c3ccccc3)C=CC(c3ccccc3)C2C(=O)N1c1cccc(Br)c1 |
| InChI | InChI=1S/C26H20BrNO2/c27-19-12-7-13-20(16-19)28-25(29)23-21(17-8-3-1-4-9-17)14-15-22(24(23)26(28)30)18-10-5-2-6-11-18/h1-16,21-24H |
| InChIKey | JLIXKQAOKIYEIN-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.36 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|