About 2-(difluoromethylsulfanyl)-N-(2,2,2-trifluoroethyl)aniline
2-(difluoromethylsulfanyl)-N-(2,2,2-trifluoroethyl)aniline (PubChem CID 28573570) has the molecular formula C9H8F5NS
and a molecular weight of 257.23 g/mol. Its IUPAC name is 2-(difluoromethylsulfanyl)-N-(2,2,2-trifluoroethyl)aniline.
Molecular Properties
| Compound Name | 2-(difluoromethylsulfanyl)-N-(2,2,2-trifluoroethyl)aniline |
| PubChem CID | 28573570 |
| Molecular Formula | C9H8F5NS |
| Molecular Weight | 257.23 g/mol |
| Exact Mass | 257.03 |
| IUPAC Name | 2-(difluoromethylsulfanyl)-N-(2,2,2-trifluoroethyl)aniline |
| SMILES | FC(F)Sc1ccccc1NCC(F)(F)F |
| InChI | InChI=1S/C9H8F5NS/c10-8(11)16-7-4-2-1-3-6(7)15-5-9(12,13)14/h1-4,8,15H,5H2 |
| InChIKey | YLJBWCPNQPRBRE-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.23 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(difluoromethylsulfanyl)-N-(2,2,2-trifluoroethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(difluoromethylsulfanyl)-N-(2,2,2-trifluoroethyl)aniline?
The IUPAC name of 2-(difluoromethylsulfanyl)-N-(2,2,2-trifluoroethyl)aniline (CID 28573570) is 2-(difluoromethylsulfanyl)-N-(2,2,2-trifluoroethyl)aniline.
What is the SMILES notation for 2-(difluoromethylsulfanyl)-N-(2,2,2-trifluoroethyl)aniline?
The canonical SMILES for 2-(difluoromethylsulfanyl)-N-(2,2,2-trifluoroethyl)aniline is FC(F)Sc1ccccc1NCC(F)(F)F.
What is the InChIKey of 2-(difluoromethylsulfanyl)-N-(2,2,2-trifluoroethyl)aniline?
The InChIKey is YLJBWCPNQPRBRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8F5NS/c10-8(11)16-7-4-2-1-3-6(7)15-5-9(12,13)14/h1-4,8,15H,5H2.
What are the key properties of 2-(difluoromethylsulfanyl)-N-(2,2,2-trifluoroethyl)aniline?
2-(difluoromethylsulfanyl)-N-(2,2,2-trifluoroethyl)aniline has a molecular weight of 257.23 g/mol, XLogP of 3.98, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(difluoromethylsulfanyl)-N-(2,2,2-trifluoroethyl)aniline is sourced from PubChem (CID 28573570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).