About 4-aminoadamantan-1-ol;hydrochloride
4-aminoadamantan-1-ol;hydrochloride (PubChem CID 2857446) has the molecular formula C10H18ClNO
and a molecular weight of 203.71 g/mol. Its IUPAC name is 4-aminoadamantan-1-ol;hydrochloride.
Molecular Properties
| Compound Name | 4-aminoadamantan-1-ol;hydrochloride |
| PubChem CID | 2857446 |
| Molecular Formula | C10H18ClNO |
| Molecular Weight | 203.71 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 4-aminoadamantan-1-ol;hydrochloride |
| SMILES | Cl.NC1C2CC3CC1CC(O)(C3)C2 |
| InChI | InChI=1S/C10H17NO.ClH/c11-9-7-1-6-2-8(9)5-10(12,3-6)4-7;/h6-9,12H,1-5,11H2;1H |
| InChIKey | KWEPNQFVPHYHHO-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.71 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-aminoadamantan-1-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminoadamantan-1-ol;hydrochloride?
The IUPAC name of 4-aminoadamantan-1-ol;hydrochloride (CID 2857446) is 4-aminoadamantan-1-ol;hydrochloride.
What is the SMILES notation for 4-aminoadamantan-1-ol;hydrochloride?
The canonical SMILES for 4-aminoadamantan-1-ol;hydrochloride is Cl.NC1C2CC3CC1CC(O)(C3)C2.
What is the InChIKey of 4-aminoadamantan-1-ol;hydrochloride?
The InChIKey is KWEPNQFVPHYHHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO.ClH/c11-9-7-1-6-2-8(9)5-10(12,3-6)4-7;/h6-9,12H,1-5,11H2;1H.
What are the key properties of 4-aminoadamantan-1-ol;hydrochloride?
4-aminoadamantan-1-ol;hydrochloride has a molecular weight of 203.71 g/mol, XLogP of 1.31, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminoadamantan-1-ol;hydrochloride is sourced from PubChem (CID 2857446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).