C22H26INO3 — CID 2857461
ethyl 2-ethyl-4-(3-iodophenyl)-7,7-dimethyl-5-oxo-1,4,6,8-tetrahydroquinoline-3-carboxylate (PubChem CID 2857461) has the molecular formula C22H26INO3 and a molecular weight of 479.36 g/mol. Its IUPAC name is ethyl 2-ethyl-4-(3-iodophenyl)-7,7-dimethyl-5-oxo-1,4,6,8-tetrahydroquinoline-3-carboxylate.
| Compound Name | ethyl 2-ethyl-4-(3-iodophenyl)-7,7-dimethyl-5-oxo-1,4,6,8-tetrahydroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 2857461 |
| Molecular Formula | C22H26INO3 |
| Molecular Weight | 479.36 g/mol |
| Exact Mass | 479.10 |
| IUPAC Name | ethyl 2-ethyl-4-(3-iodophenyl)-7,7-dimethyl-5-oxo-1,4,6,8-tetrahydroquinoline-3-carboxylate |
| SMILES | CCOC(=O)C1=C(CC)NC2=C(C(=O)CC(C)(C)C2)C1c1cccc(I)c1 |
| InChI | InChI=1S/C22H26INO3/c1-5-15-20(21(26)27-6-2)18(13-8-7-9-14(23)10-13)19-16(24-15)11-22(3,4)12-17(19)25/h7-10,18,24H,5-6,11-12H2,1-4H3 |
| InChIKey | QFGILTOMLRENTM-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.36 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|