C20H22BrN3O6S — CID 28574893
1-[(4-bromophenyl)methylsulfonyl]-N-(2-methoxy-5-nitrophenyl)piperidine-4-carboxamide (PubChem CID 28574893) has the molecular formula C20H22BrN3O6S and a molecular weight of 512.38 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methylsulfonyl]-N-(2-methoxy-5-nitrophenyl)piperidine-4-carboxamide.
| Compound Name | 1-[(4-bromophenyl)methylsulfonyl]-N-(2-methoxy-5-nitrophenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 28574893 |
| Molecular Formula | C20H22BrN3O6S |
| Molecular Weight | 512.38 g/mol |
| Exact Mass | 511.04 |
| IUPAC Name | 1-[(4-bromophenyl)methylsulfonyl]-N-(2-methoxy-5-nitrophenyl)piperidine-4-carboxamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)C1CCN(S(=O)(=O)Cc2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C20H22BrN3O6S/c1-30-19-7-6-17(24(26)27)12-18(19)22-20(25)15-8-10-23(11-9-15)31(28,29)13-14-2-4-16(21)5-3-14/h2-7,12,15H,8-11,13H2,1H3,(H,22,25) |
| InChIKey | BVXJSYWSITYAJP-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.38 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|