About N-[(2-chloro-4-fluorophenyl)methyl]-3,4-dimethoxyaniline
N-[(2-chloro-4-fluorophenyl)methyl]-3,4-dimethoxyaniline (PubChem CID 28575176) has the molecular formula C15H15ClFNO2
and a molecular weight of 295.74 g/mol. Its IUPAC name is N-[(2-chloro-4-fluorophenyl)methyl]-3,4-dimethoxyaniline.
Molecular Properties
| Compound Name | N-[(2-chloro-4-fluorophenyl)methyl]-3,4-dimethoxyaniline |
| PubChem CID | 28575176 |
| Molecular Formula | C15H15ClFNO2 |
| Molecular Weight | 295.74 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | N-[(2-chloro-4-fluorophenyl)methyl]-3,4-dimethoxyaniline |
| SMILES | COc1ccc(NCc2ccc(F)cc2Cl)cc1OC |
| InChI | InChI=1S/C15H15ClFNO2/c1-19-14-6-5-12(8-15(14)20-2)18-9-10-3-4-11(17)7-13(10)16/h3-8,18H,9H2,1-2H3 |
| InChIKey | XAVPXDVUTMHKET-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.74 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze N-[(2-chloro-4-fluorophenyl)methyl]-3,4-dimethoxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2-chloro-4-fluorophenyl)methyl]-3,4-dimethoxyaniline?
The IUPAC name of N-[(2-chloro-4-fluorophenyl)methyl]-3,4-dimethoxyaniline (CID 28575176) is N-[(2-chloro-4-fluorophenyl)methyl]-3,4-dimethoxyaniline.
What is the SMILES notation for N-[(2-chloro-4-fluorophenyl)methyl]-3,4-dimethoxyaniline?
The canonical SMILES for N-[(2-chloro-4-fluorophenyl)methyl]-3,4-dimethoxyaniline is COc1ccc(NCc2ccc(F)cc2Cl)cc1OC.
What is the InChIKey of N-[(2-chloro-4-fluorophenyl)methyl]-3,4-dimethoxyaniline?
The InChIKey is XAVPXDVUTMHKET-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15ClFNO2/c1-19-14-6-5-12(8-15(14)20-2)18-9-10-3-4-11(17)7-13(10)16/h3-8,18H,9H2,1-2H3.
What are the key properties of N-[(2-chloro-4-fluorophenyl)methyl]-3,4-dimethoxyaniline?
N-[(2-chloro-4-fluorophenyl)methyl]-3,4-dimethoxyaniline has a molecular weight of 295.74 g/mol, XLogP of 4.11, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2-chloro-4-fluorophenyl)methyl]-3,4-dimethoxyaniline is sourced from PubChem (CID 28575176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).