C16H15FN2O2 — CID 28575181
4-[(3,4-dimethoxyanilino)methyl]-3-fluorobenzonitrile (PubChem CID 28575181) has the molecular formula C16H15FN2O2 and a molecular weight of 286.31 g/mol. Its IUPAC name is 4-[(3,4-dimethoxyanilino)methyl]-3-fluorobenzonitrile.
| Compound Name | 4-[(3,4-dimethoxyanilino)methyl]-3-fluorobenzonitrile |
|---|---|
| PubChem CID | 28575181 |
| Molecular Formula | C16H15FN2O2 |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 4-[(3,4-dimethoxyanilino)methyl]-3-fluorobenzonitrile |
| SMILES | COc1ccc(NCc2ccc(C#N)cc2F)cc1OC |
| InChI | InChI=1S/C16H15FN2O2/c1-20-15-6-5-13(8-16(15)21-2)19-10-12-4-3-11(9-18)7-14(12)17/h3-8,19H,10H2,1-2H3 |
| InChIKey | XGEBHOKYESNUTG-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|