C24H32N2O5S — CID 28576425
N-[(3,4-diethoxyphenyl)methyl]-4-(piperidin-1-ylsulfonylmethyl)benzamide (PubChem CID 28576425) has the molecular formula C24H32N2O5S and a molecular weight of 460.60 g/mol. Its IUPAC name is N-[(3,4-diethoxyphenyl)methyl]-4-(piperidin-1-ylsulfonylmethyl)benzamide.
| Compound Name | N-[(3,4-diethoxyphenyl)methyl]-4-(piperidin-1-ylsulfonylmethyl)benzamide |
|---|---|
| PubChem CID | 28576425 |
| Molecular Formula | C24H32N2O5S |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | N-[(3,4-diethoxyphenyl)methyl]-4-(piperidin-1-ylsulfonylmethyl)benzamide |
| SMILES | CCOc1ccc(CNC(=O)c2ccc(CS(=O)(=O)N3CCCCC3)cc2)cc1OCC |
| InChI | InChI=1S/C24H32N2O5S/c1-3-30-22-13-10-20(16-23(22)31-4-2)17-25-24(27)21-11-8-19(9-12-21)18-32(28,29)26-14-6-5-7-15-26/h8-13,16H,3-7,14-15,17-18H2,1-2H3,(H,25,27) |
| InChIKey | GMPCVKONVVCCGO-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |