C17H17Cl2NO3 — CID 28577552
(2R)-N-(2,6-dichlorophenyl)-2-(3-methoxyphenoxy)butanamide (PubChem CID 28577552) has the molecular formula C17H17Cl2NO3 and a molecular weight of 354.23 g/mol. Its IUPAC name is (2R)-N-(2,6-dichlorophenyl)-2-(3-methoxyphenoxy)butanamide.
| Compound Name | (2R)-N-(2,6-dichlorophenyl)-2-(3-methoxyphenoxy)butanamide |
|---|---|
| PubChem CID | 28577552 |
| Molecular Formula | C17H17Cl2NO3 |
| Molecular Weight | 354.23 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | (2R)-N-(2,6-dichlorophenyl)-2-(3-methoxyphenoxy)butanamide |
| SMILES | CC[C@@H](Oc1cccc(OC)c1)C(=O)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C17H17Cl2NO3/c1-3-15(23-12-7-4-6-11(10-12)22-2)17(21)20-16-13(18)8-5-9-14(16)19/h4-10,15H,3H2,1-2H3,(H,20,21)/t15-/m1/s1 |
| InChIKey | NQYMXCKBSRIACT-OAHLLOKOSA-N |
| XLogP | 4.80 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.23 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |