C14H9Cl2FN2 — CID 28577948
3-[(3,4-dichloroanilino)methyl]-4-fluorobenzonitrile (PubChem CID 28577948) has the molecular formula C14H9Cl2FN2 and a molecular weight of 295.14 g/mol. Its IUPAC name is 3-[(3,4-dichloroanilino)methyl]-4-fluorobenzonitrile.
| Compound Name | 3-[(3,4-dichloroanilino)methyl]-4-fluorobenzonitrile |
|---|---|
| PubChem CID | 28577948 |
| Molecular Formula | C14H9Cl2FN2 |
| Molecular Weight | 295.14 g/mol |
| Exact Mass | 294.01 |
| IUPAC Name | 3-[(3,4-dichloroanilino)methyl]-4-fluorobenzonitrile |
| SMILES | N#Cc1ccc(F)c(CNc2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C14H9Cl2FN2/c15-12-3-2-11(6-13(12)16)19-8-10-5-9(7-18)1-4-14(10)17/h1-6,19H,8H2 |
| InChIKey | DDLVMUIZOMPMFI-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.14 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |