C10H14N2O — CID 28580413
2-(3,4-dimethylanilino)acetamide (PubChem CID 28580413) has the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. Its IUPAC name is 2-(3,4-dimethylanilino)acetamide.
| Compound Name | 2-(3,4-dimethylanilino)acetamide |
|---|---|
| PubChem CID | 28580413 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 2-(3,4-dimethylanilino)acetamide |
| SMILES | Cc1ccc(NCC(N)=O)cc1C |
| InChI | InChI=1S/C10H14N2O/c1-7-3-4-9(5-8(7)2)12-6-10(11)13/h3-5,12H,6H2,1-2H3,(H2,11,13) |
| InChIKey | SJZKKGONZDXGFW-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |