C24H22N2O7S3 — CID 2858073
dimethyl 2-[1-[2-(2,5-dioxopyrrolidin-1-yl)acetyl]-2,2-dimethyl-3-sulfanylidenequinolin-4-ylidene]-1,3-dithiole-4,5-dicarboxylate (PubChem CID 2858073) has the molecular formula C24H22N2O7S3 and a molecular weight of 546.65 g/mol. Its IUPAC name is dimethyl 2-[1-[2-(2,5-dioxopyrrolidin-1-yl)acetyl]-2,2-dimethyl-3-sulfanylidenequinolin-4-ylidene]-1,3-dithiole-4,5-dicarboxylate.
| Compound Name | dimethyl 2-[1-[2-(2,5-dioxopyrrolidin-1-yl)acetyl]-2,2-dimethyl-3-sulfanylidenequinolin-4-ylidene]-1,3-dithiole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 2858073 |
| Molecular Formula | C24H22N2O7S3 |
| Molecular Weight | 546.65 g/mol |
| Exact Mass | 546.06 |
| IUPAC Name | dimethyl 2-[1-[2-(2,5-dioxopyrrolidin-1-yl)acetyl]-2,2-dimethyl-3-sulfanylidenequinolin-4-ylidene]-1,3-dithiole-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)SC(=C2C(=S)C(C)(C)N(C(=O)CN3C(=O)CCC3=O)c3ccccc32)S1 |
| InChI | InChI=1S/C24H22N2O7S3/c1-24(2)20(34)17(23-35-18(21(30)32-3)19(36-23)22(31)33-4)12-7-5-6-8-13(12)26(24)16(29)11-25-14(27)9-10-15(25)28/h5-8H,9-11H2,1-4H3 |
| InChIKey | CUUNGZJUKKGJEA-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 110.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.65 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|