About 4-(1-tricyclo[4.3.1.13,8]undecanylmethyl)morpholine;hydrochloride
4-(1-tricyclo[4.3.1.13,8]undecanylmethyl)morpholine;hydrochloride (PubChem CID 2858113) has the molecular formula C16H28ClNO
and a molecular weight of 285.86 g/mol. Its IUPAC name is 4-(1-tricyclo[4.3.1.13,8]undecanylmethyl)morpholine;hydrochloride.
Molecular Properties
| Compound Name | 4-(1-tricyclo[4.3.1.13,8]undecanylmethyl)morpholine;hydrochloride |
| PubChem CID | 2858113 |
| Molecular Formula | C16H28ClNO |
| Molecular Weight | 285.86 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | 4-(1-tricyclo[4.3.1.13,8]undecanylmethyl)morpholine;hydrochloride |
| SMILES | C1CN(CC23CC4CCC(CC(C4)C2)C3)CCO1.Cl |
| InChI | InChI=1S/C16H27NO.ClH/c1-2-14-8-15-7-13(1)9-16(10-14,11-15)12-17-3-5-18-6-4-17;/h13-15H,1-12H2;1H |
| InChIKey | WKXWXBLLYIZXAE-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.86 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(1-tricyclo[4.3.1.13,8]undecanylmethyl)morpholine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-tricyclo[4.3.1.13,8]undecanylmethyl)morpholine;hydrochloride?
The IUPAC name of 4-(1-tricyclo[4.3.1.13,8]undecanylmethyl)morpholine;hydrochloride (CID 2858113) is 4-(1-tricyclo[4.3.1.13,8]undecanylmethyl)morpholine;hydrochloride.
What is the SMILES notation for 4-(1-tricyclo[4.3.1.13,8]undecanylmethyl)morpholine;hydrochloride?
The canonical SMILES for 4-(1-tricyclo[4.3.1.13,8]undecanylmethyl)morpholine;hydrochloride is C1CN(CC23CC4CCC(CC(C4)C2)C3)CCO1.Cl.
What is the InChIKey of 4-(1-tricyclo[4.3.1.13,8]undecanylmethyl)morpholine;hydrochloride?
The InChIKey is WKXWXBLLYIZXAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27NO.ClH/c1-2-14-8-15-7-13(1)9-16(10-14,11-15)12-17-3-5-18-6-4-17;/h13-15H,1-12H2;1H.
What are the key properties of 4-(1-tricyclo[4.3.1.13,8]undecanylmethyl)morpholine;hydrochloride?
4-(1-tricyclo[4.3.1.13,8]undecanylmethyl)morpholine;hydrochloride has a molecular weight of 285.86 g/mol, XLogP of 3.35, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-tricyclo[4.3.1.13,8]undecanylmethyl)morpholine;hydrochloride is sourced from PubChem (CID 2858113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).