About 3-bromo-N-pentylaniline
3-bromo-N-pentylaniline (PubChem CID 28581238) has the molecular formula C11H16BrN
and a molecular weight of 242.16 g/mol. Its IUPAC name is 3-bromo-N-pentylaniline.
Molecular Properties
| Compound Name | 3-bromo-N-pentylaniline |
| PubChem CID | 28581238 |
| Molecular Formula | C11H16BrN |
| Molecular Weight | 242.16 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | 3-bromo-N-pentylaniline |
| SMILES | CCCCCNc1cccc(Br)c1 |
| InChI | InChI=1S/C11H16BrN/c1-2-3-4-8-13-11-7-5-6-10(12)9-11/h5-7,9,13H,2-4,8H2,1H3 |
| InChIKey | OXOFCWJSFULQMU-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.16 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-N-pentylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-N-pentylaniline?
The IUPAC name of 3-bromo-N-pentylaniline (CID 28581238) is 3-bromo-N-pentylaniline.
What is the SMILES notation for 3-bromo-N-pentylaniline?
The canonical SMILES for 3-bromo-N-pentylaniline is CCCCCNc1cccc(Br)c1.
What is the InChIKey of 3-bromo-N-pentylaniline?
The InChIKey is OXOFCWJSFULQMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16BrN/c1-2-3-4-8-13-11-7-5-6-10(12)9-11/h5-7,9,13H,2-4,8H2,1H3.
What are the key properties of 3-bromo-N-pentylaniline?
3-bromo-N-pentylaniline has a molecular weight of 242.16 g/mol, XLogP of 4.05, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-N-pentylaniline is sourced from PubChem (CID 28581238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).