C17H12BrN3O2 — CID 2858224
2-(1H-benzimidazol-2-yl)-3-(2-bromo-4-hydroxy-5-methoxyphenyl)prop-2-enenitrile (PubChem CID 2858224) has the molecular formula C17H12BrN3O2 and a molecular weight of 370.21 g/mol. Its IUPAC name is 2-(1H-benzimidazol-2-yl)-3-(2-bromo-4-hydroxy-5-methoxyphenyl)prop-2-enenitrile.
| Compound Name | 2-(1H-benzimidazol-2-yl)-3-(2-bromo-4-hydroxy-5-methoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 2858224 |
| Molecular Formula | C17H12BrN3O2 |
| Molecular Weight | 370.21 g/mol |
| Exact Mass | 369.01 |
| IUPAC Name | 2-(1H-benzimidazol-2-yl)-3-(2-bromo-4-hydroxy-5-methoxyphenyl)prop-2-enenitrile |
| SMILES | COc1cc(C=C(C#N)c2nc3ccccc3[nH]2)c(Br)cc1O |
| InChI | InChI=1S/C17H12BrN3O2/c1-23-16-7-10(12(18)8-15(16)22)6-11(9-19)17-20-13-4-2-3-5-14(13)21-17/h2-8,22H,1H3,(H,20,21) |
| InChIKey | GHMRUNOHAHJNNA-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.21 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|