About (4,7,7-trimethyl-3-bicyclo[4.1.0]hept-4-enyl)methyl 2-piperidin-1-ylacetate
(4,7,7-trimethyl-3-bicyclo[4.1.0]hept-4-enyl)methyl 2-piperidin-1-ylacetate (PubChem CID 2858367) has the molecular formula C18H29NO2
and a molecular weight of 291.44 g/mol. Its IUPAC name is (4,7,7-trimethyl-3-bicyclo[4.1.0]hept-4-enyl)methyl 2-piperidin-1-ylacetate.
Molecular Properties
| Compound Name | (4,7,7-trimethyl-3-bicyclo[4.1.0]hept-4-enyl)methyl 2-piperidin-1-ylacetate |
| PubChem CID | 2858367 |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | (4,7,7-trimethyl-3-bicyclo[4.1.0]hept-4-enyl)methyl 2-piperidin-1-ylacetate |
| SMILES | CC1=CC2C(CC1COC(=O)CN1CCCCC1)C2(C)C |
| InChI | InChI=1S/C18H29NO2/c1-13-9-15-16(18(15,2)3)10-14(13)12-21-17(20)11-19-7-5-4-6-8-19/h9,14-16H,4-8,10-12H2,1-3H3 |
| InChIKey | FMQARPSTZNNDJH-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4,7,7-trimethyl-3-bicyclo[4.1.0]hept-4-enyl)methyl 2-piperidin-1-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,7,7-trimethyl-3-bicyclo[4.1.0]hept-4-enyl)methyl 2-piperidin-1-ylacetate?
The IUPAC name of (4,7,7-trimethyl-3-bicyclo[4.1.0]hept-4-enyl)methyl 2-piperidin-1-ylacetate (CID 2858367) is (4,7,7-trimethyl-3-bicyclo[4.1.0]hept-4-enyl)methyl 2-piperidin-1-ylacetate.
What is the SMILES notation for (4,7,7-trimethyl-3-bicyclo[4.1.0]hept-4-enyl)methyl 2-piperidin-1-ylacetate?
The canonical SMILES for (4,7,7-trimethyl-3-bicyclo[4.1.0]hept-4-enyl)methyl 2-piperidin-1-ylacetate is CC1=CC2C(CC1COC(=O)CN1CCCCC1)C2(C)C.
What is the InChIKey of (4,7,7-trimethyl-3-bicyclo[4.1.0]hept-4-enyl)methyl 2-piperidin-1-ylacetate?
The InChIKey is FMQARPSTZNNDJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29NO2/c1-13-9-15-16(18(15,2)3)10-14(13)12-21-17(20)11-19-7-5-4-6-8-19/h9,14-16H,4-8,10-12H2,1-3H3.
What are the key properties of (4,7,7-trimethyl-3-bicyclo[4.1.0]hept-4-enyl)methyl 2-piperidin-1-ylacetate?
(4,7,7-trimethyl-3-bicyclo[4.1.0]hept-4-enyl)methyl 2-piperidin-1-ylacetate has a molecular weight of 291.44 g/mol, XLogP of 3.25, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4,7,7-trimethyl-3-bicyclo[4.1.0]hept-4-enyl)methyl 2-piperidin-1-ylacetate is sourced from PubChem (CID 2858367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).