About 5-(4-fluorophenyl)-1H-1,2,4-triazol-3-amine;hydrochloride
5-(4-fluorophenyl)-1H-1,2,4-triazol-3-amine;hydrochloride (PubChem CID 2858656) has the molecular formula C8H8ClFN4
and a molecular weight of 214.63 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-1H-1,2,4-triazol-3-amine;hydrochloride.
Molecular Properties
| Compound Name | 5-(4-fluorophenyl)-1H-1,2,4-triazol-3-amine;hydrochloride |
| PubChem CID | 2858656 |
| Molecular Formula | C8H8ClFN4 |
| Molecular Weight | 214.63 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | 5-(4-fluorophenyl)-1H-1,2,4-triazol-3-amine;hydrochloride |
| SMILES | Cl.Nc1n[nH]c(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C8H7FN4.ClH/c9-6-3-1-5(2-4-6)7-11-8(10)13-12-7;/h1-4H,(H3,10,11,12,13);1H |
| InChIKey | MQWOLWPUJNNFDW-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.63 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(4-fluorophenyl)-1H-1,2,4-triazol-3-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-fluorophenyl)-1H-1,2,4-triazol-3-amine;hydrochloride?
The IUPAC name of 5-(4-fluorophenyl)-1H-1,2,4-triazol-3-amine;hydrochloride (CID 2858656) is 5-(4-fluorophenyl)-1H-1,2,4-triazol-3-amine;hydrochloride.
What is the SMILES notation for 5-(4-fluorophenyl)-1H-1,2,4-triazol-3-amine;hydrochloride?
The canonical SMILES for 5-(4-fluorophenyl)-1H-1,2,4-triazol-3-amine;hydrochloride is Cl.Nc1n[nH]c(-c2ccc(F)cc2)n1.
What is the InChIKey of 5-(4-fluorophenyl)-1H-1,2,4-triazol-3-amine;hydrochloride?
The InChIKey is MQWOLWPUJNNFDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7FN4.ClH/c9-6-3-1-5(2-4-6)7-11-8(10)13-12-7;/h1-4H,(H3,10,11,12,13);1H.
What are the key properties of 5-(4-fluorophenyl)-1H-1,2,4-triazol-3-amine;hydrochloride?
5-(4-fluorophenyl)-1H-1,2,4-triazol-3-amine;hydrochloride has a molecular weight of 214.63 g/mol, XLogP of 1.61, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-fluorophenyl)-1H-1,2,4-triazol-3-amine;hydrochloride is sourced from PubChem (CID 2858656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).