C20H30N2O — CID 28587550
(2S)-2-(butylamino)-3,4-dimethyl-1-[(2R)-4-phenylbutan-2-yl]-2H-pyrrol-5-one (PubChem CID 28587550) has the molecular formula C20H30N2O and a molecular weight of 314.47 g/mol. Its IUPAC name is (2S)-2-(butylamino)-3,4-dimethyl-1-[(2R)-4-phenylbutan-2-yl]-2H-pyrrol-5-one.
| Compound Name | (2S)-2-(butylamino)-3,4-dimethyl-1-[(2R)-4-phenylbutan-2-yl]-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 28587550 |
| Molecular Formula | C20H30N2O |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.24 |
| IUPAC Name | (2S)-2-(butylamino)-3,4-dimethyl-1-[(2R)-4-phenylbutan-2-yl]-2H-pyrrol-5-one |
| SMILES | CCCCN[C@@H]1C(C)=C(C)C(=O)N1[C@H](C)CCc1ccccc1 |
| InChI | InChI=1S/C20H30N2O/c1-5-6-14-21-19-16(3)17(4)20(23)22(19)15(2)12-13-18-10-8-7-9-11-18/h7-11,15,19,21H,5-6,12-14H2,1-4H3/t15-,19+/m1/s1 |
| InChIKey | SSBLOYDKKYDGAY-BEFAXECRSA-N |
| XLogP | 3.90 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|