C18H17ClO5 — CID 28587989
methyl 5-chloro-2-[2-(2,4-dimethylphenoxy)acetyl]oxybenzoate (PubChem CID 28587989) has the molecular formula C18H17ClO5 and a molecular weight of 348.78 g/mol. Its IUPAC name is methyl 5-chloro-2-[2-(2,4-dimethylphenoxy)acetyl]oxybenzoate.
| Compound Name | methyl 5-chloro-2-[2-(2,4-dimethylphenoxy)acetyl]oxybenzoate |
|---|---|
| PubChem CID | 28587989 |
| Molecular Formula | C18H17ClO5 |
| Molecular Weight | 348.78 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | methyl 5-chloro-2-[2-(2,4-dimethylphenoxy)acetyl]oxybenzoate |
| SMILES | COC(=O)c1cc(Cl)ccc1OC(=O)COc1ccc(C)cc1C |
| InChI | InChI=1S/C18H17ClO5/c1-11-4-6-15(12(2)8-11)23-10-17(20)24-16-7-5-13(19)9-14(16)18(21)22-3/h4-9H,10H2,1-3H3 |
| InChIKey | WOGPJJGILIXEJG-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.78 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|