C15H9ClN2O8 — CID 28587997
methyl 5-chloro-2-(3,5-dinitrobenzoyl)oxybenzoate (PubChem CID 28587997) has the molecular formula C15H9ClN2O8 and a molecular weight of 380.70 g/mol. Its IUPAC name is methyl 5-chloro-2-(3,5-dinitrobenzoyl)oxybenzoate.
| Compound Name | methyl 5-chloro-2-(3,5-dinitrobenzoyl)oxybenzoate |
|---|---|
| PubChem CID | 28587997 |
| Molecular Formula | C15H9ClN2O8 |
| Molecular Weight | 380.70 g/mol |
| Exact Mass | 380.00 |
| IUPAC Name | methyl 5-chloro-2-(3,5-dinitrobenzoyl)oxybenzoate |
| SMILES | COC(=O)c1cc(Cl)ccc1OC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H9ClN2O8/c1-25-15(20)12-6-9(16)2-3-13(12)26-14(19)8-4-10(17(21)22)7-11(5-8)18(23)24/h2-7H,1H3 |
| InChIKey | DKLWVVLJHKMDHR-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 138.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.70 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|