C19H20ClN3O2 — CID 2858826
1-(4-chlorophenoxy)-3-(2-imino-3-prop-2-enylbenzimidazol-1-yl)propan-2-ol (PubChem CID 2858826) has the molecular formula C19H20ClN3O2 and a molecular weight of 357.84 g/mol. Its IUPAC name is 1-(4-chlorophenoxy)-3-(2-imino-3-prop-2-enylbenzimidazol-1-yl)propan-2-ol.
| Compound Name | 1-(4-chlorophenoxy)-3-(2-imino-3-prop-2-enylbenzimidazol-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 2858826 |
| Molecular Formula | C19H20ClN3O2 |
| Molecular Weight | 357.84 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 1-(4-chlorophenoxy)-3-(2-imino-3-prop-2-enylbenzimidazol-1-yl)propan-2-ol |
| SMILES | [H]/N=c1\n(CC=C)c2ccccc2n1CC(O)COc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H20ClN3O2/c1-2-11-22-17-5-3-4-6-18(17)23(19(22)21)12-15(24)13-25-16-9-7-14(20)8-10-16/h2-10,15,21,24H,1,11-13H2/b21-19+ |
| InChIKey | UIEXGTBWIWQHIP-XUTLUUPISA-N |
| XLogP | 3.20 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.84 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|