C20H23ClN4O3S — CID 2858984
2-[N-(benzenesulfonyl)-3-chloroanilino]-N-[(1-methylpiperidin-4-ylidene)amino]acetamide (PubChem CID 2858984) has the molecular formula C20H23ClN4O3S and a molecular weight of 434.95 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-3-chloroanilino]-N-[(1-methylpiperidin-4-ylidene)amino]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-3-chloroanilino]-N-[(1-methylpiperidin-4-ylidene)amino]acetamide |
|---|---|
| PubChem CID | 2858984 |
| Molecular Formula | C20H23ClN4O3S |
| Molecular Weight | 434.95 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-3-chloroanilino]-N-[(1-methylpiperidin-4-ylidene)amino]acetamide |
| SMILES | CN1CCC(=NNC(=O)CN(c2cccc(Cl)c2)S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C20H23ClN4O3S/c1-24-12-10-17(11-13-24)22-23-20(26)15-25(18-7-5-6-16(21)14-18)29(27,28)19-8-3-2-4-9-19/h2-9,14H,10-13,15H2,1H3,(H,23,26) |
| InChIKey | QTGCTGGCILSIKQ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.95 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|